Andoza:Bilgiquti mineral/doc

This template is used on pages about minerals as well as gemstones to provide handy easy to access data about that mineral.

Usage

Most field names are in lowercase.

Copy a blank version to use. Please delete any unused fields to avoid clutter in the edit window. Andoza:Bilgiquti mineral

{{Bilgiquti mineral
| name        = 
| boxwidth    = 
| boxbgcolor  = 
| image       = 
| imagesize   = 
| alt         = 
| caption     = 
| struct image     =
| struct caption   =
| struct imagesize =
| struct2 image    =
| struct2 caption  =
| struct2 imagesize=
| SMILES           =
| Jmol             =
| category    = 
| formula     = 
| molweight   = 
| strunz      = 
| dana        = 
| system      = 
| class       = 
| symmetry    = 
| unit cell   = 
| color       = 
| colour      = 
| habit       = 
| twinning    = 
| cleavage    = 
| fracture    = 
| tenacity    = 
| toughness   = 
| mohs        = 
| luster      = 
| streak      = 
| diaphaneity = 
| gravity     = 
| density     = 
| polish      = 
| opticalprop = 
| refractive  = 
| birefringence = 
| pleochroism = 
| 2V          = 
| dispersion  = 
| extinction  = 
| length fast/slow =
| fluorescence = 
| absorption  = 
| melt        = 
| Curie temp  = 
| fusibility  = 
| diagnostic  = 
| solubility  = 
| impurities  = 
| alteration  = 
| other       = 
| prop1       = 
| prop1text   = 
| references  = 
| var1        = 
| var1text    = 
| var2        = 
| var2text    = 
| var3        = 
| var3text    = 
| var4        = 
| var4text    = 
| var5        = 
| var5text    = 
| var6        = 
| var6text    = 
}}

All parameters used

| image = Tridymite tabulars - Ochtendung, Eifel, Germany.jpg
| imagesize   = 260px

|struct image=a-tridymite.png
|struct caption=Crystal structure of α-tridymite
|struct imagesize=150px
|struct2 image=Diamond lattice.stl
|struct2 caption=Some other image
|struct2 imagesize=200px

|SMILES = O[C@@H]4C/C3=C/C=C1\[C@H](CC[C@]2([C@H]1CC[C@@H]2[C@H](C)CCCC(C)C)C)[C@@]3(C)CC4
|Jmol= C([C@@H]([C@@H]1C(=C(C(=O)O1)O)O)O)O<!-- different so will show difgferent struct - to test -->
|boxbgcolor = yellow

| 2V = 2V
| absorption = absorption
| alt = alt
| alteration = alteration
| birefringence = birefringence
| boxtextcolor = boxtextcolor
| boxwidth = boxwidth
| caption = caption
| category = category
| class = class
| cleavage = cleavage
| color = color
| colour = colour
| dana = dana
| density = density
| diagnostic = diagnostic
| diaphaneity = diaphaneity
| dispersion = dispersion
| extinction = extinction
| fluorescence = fluorescence
| formula = formula
| fracture = fracture
| fusibility = fusibility
| gravity = gravity
| habit = habit
| impurities = impurities
| length fast/slow = length fast/slow
| luster = luster
| lustre = lustre
| melt = melt
| mohs = mohs
| molweight = molweight
| name = name
| opticalprop = opticalprop
| other = other
| pleochroism = pleochroism
| polish = polish
| polish lustre = polish lustre
| prop1 = prop1
| prop1text = prop1text
| references = references
| refractive = refractive
| solubility = solubility
| streak = streak
| strunz = strunz
| symmetry = symmetry
| system = system
| tenacity = tenacity
| twinning = twinning
| unit cell = unit cell
| var1 = var1
| var1text = var1text
| var2 = var2
| var2text = var2text
| var3 = var3
| var3text = var3text
| var4 = var4
| var4text = var4text
| var5 = var5
| var5text = var5text
| var6 = var6
| var6text = var6text

Description

This should describe the parameters used in this template.

Parameter	Explanation	Example
name	IMA mineral name (IMA Symbol; if there is another common name, put it in parentheses)	Baryte (Barite)
boxwidth
boxbgcolor	Background color of box headers
boxtextcolor	Text color of box headers
image	Wikimedia Commons image filename (to go at top)	Epidoto.jpeg
imagesize
alt	alt text for image, for visually impaired readers; see WP:ALT	Agglomeration of dark cylindrical crystals
caption	image caption	Epidote crystals
category	broad group then subgroup then sub-subgroup (if applicable) template does not auto-link	Sulfate minerals, Barite group
formula	chemical formula giving the elemental composition of a repeating unit of an alloy, a polymer, a crystal structure, a chain, or a network	BaSO4
strunz	Nickel-Strunz classification of the mineral (10 ed, MinDat)	9.BG.05
dana	Dana classification of the mineral	28.03.01.01
symmetry	Hermann–Mauguin notation of the mineral's symmetry element, labeled: Space group
unit cell	Unit cell dimensions and number (Z) of formula units per unit cell
molweight	molar mass of the chemical formula above
color	common colors of the mineral
colour	same as above, but for British pages
habit	common mineral habit
system	crystal system (cubic, etc.)
class	crystal class
twinning	common type of twinning
cleavage	type of cleavage
fracture	type of fracture (appearance of broken surface)	irregular
tenacity	tenacity (how the mineral can deform or break)	brittle
toughness	toughness (quantitative resistance to deformation or breakage)
mohs	hardness (scratchability) of mineral on Mohs hardness scale	3-3.5
luster	way the mineral reflects light, see luster
lustre	same as above, but for British pages
streak	see streak
diaphaneity	transparency of mineral
gravity	specific gravity
density	density at STP in g/cm3
polish	ability to take a polish
opticalprop
refractive	refractive index of mineral
birefringence	birefringence of a 30micron thin section
pleochroism	see pleochroism
2V	2V angle
dispersion	see dispersion
extinction	extinction angle, e.g. "parallel", or "inclined" and a quantitative angle. Irrelevant for minerals without an extinction angle (isotropic, opaque, or amorphous minerals).
length fast/slow	Sign of elongation: length fast or length slow
fluorescence	see fluorescence
absorption	see absorption
melt	melting point of mineral
Curie	Curie temperature of mineral
fusibility	fusibility of mineral
diagnostic	key way to recognize mineral
solubility	solubility of mineral in water at STP
impurities	common impurities
alteration	alteration products
other
prop1
prop1text
references	use the Wikipedia template:ref to cite	References supporting the properties to be added at that line using <ref>...</ref> tag notation. Individual items can be tagged separately if needed.
var1
var1text
var2
var2text
var3
var3text
var4
var4text
var5
var5text
var6
var6text

TemplateData

Bu TemplateData TemplateWizard, VisualEditor va boshqa vositalar uchun ishlab chiqilgan.

Bilgiquti mineral uchun TemplateData

Tavsif yoʻq.

Andoza parametrlari

Parametr		Tavsif	Turi	Status
boxwidth	boxwidth	tavsif yoʻq	Nomaʼlum	ixtiyoriy
boxtextcolor	boxtextcolor	tavsif yoʻq	Nomaʼlum	ixtiyoriy
boxbgcolor	boxbgcolor	tavsif yoʻq	Nomaʼlum	ixtiyoriy
name	name	tavsif yoʻq	Nomaʼlum	ixtiyoriy
image	image	tavsif yoʻq	Nomaʼlum	ixtiyoriy
imagesize	imagesize	tavsif yoʻq	Nomaʼlum	ixtiyoriy
alt	alt	tavsif yoʻq	Nomaʼlum	ixtiyoriy
caption	caption	tavsif yoʻq	Nomaʼlum	ixtiyoriy
category	category	tavsif yoʻq	Nomaʼlum	ixtiyoriy
formula	formula	tavsif yoʻq	Nomaʼlum	ixtiyoriy
strunz	strunz	tavsif yoʻq	Nomaʼlum	ixtiyoriy
system	system	tavsif yoʻq	Nomaʼlum	ixtiyoriy
dana	dana	tavsif yoʻq	Nomaʼlum	ixtiyoriy
class	class	tavsif yoʻq	Nomaʼlum	ixtiyoriy
symmetry	symmetry	tavsif yoʻq	Nomaʼlum	ixtiyoriy
IMA symbol	IMA symbol	tavsif yoʻq	Nomaʼlum	ixtiyoriy
molweight	molweight	tavsif yoʻq	Nomaʼlum	ixtiyoriy
unit cell	unit cell	tavsif yoʻq	Nomaʼlum	ixtiyoriy
color	color	tavsif yoʻq	Nomaʼlum	ixtiyoriy
habit	habit	tavsif yoʻq	Nomaʼlum	ixtiyoriy
twinning	twinning	tavsif yoʻq	Nomaʼlum	ixtiyoriy
cleavage	cleavage	tavsif yoʻq	Nomaʼlum	ixtiyoriy
fracture	fracture	tavsif yoʻq	Nomaʼlum	ixtiyoriy
tenacity	tenacity	tavsif yoʻq	Nomaʼlum	ixtiyoriy
mohs	mohs	tavsif yoʻq	Nomaʼlum	ixtiyoriy
luster	luster	tavsif yoʻq	Nomaʼlum	ixtiyoriy
polish	polish	tavsif yoʻq	Nomaʼlum	ixtiyoriy
opticalprop	opticalprop	tavsif yoʻq	Nomaʼlum	ixtiyoriy
refractive	refractive	tavsif yoʻq	Nomaʼlum	ixtiyoriy
birefringence	birefringence	tavsif yoʻq	Nomaʼlum	ixtiyoriy
pleochroism	pleochroism	tavsif yoʻq	Nomaʼlum	ixtiyoriy
2V	2V	tavsif yoʻq	Nomaʼlum	ixtiyoriy
dispersion	dispersion	tavsif yoʻq	Nomaʼlum	ixtiyoriy
extinction	extinction	tavsif yoʻq	Nomaʼlum	ixtiyoriy
length fast/slow	length fast/slow	tavsif yoʻq	Nomaʼlum	ixtiyoriy
fluorescence	fluorescence	tavsif yoʻq	Nomaʼlum	ixtiyoriy
absorption	absorption	tavsif yoʻq	Nomaʼlum	ixtiyoriy
streak	streak	tavsif yoʻq	Nomaʼlum	ixtiyoriy
gravity	gravity	tavsif yoʻq	Nomaʼlum	ixtiyoriy
density	density	tavsif yoʻq	Nomaʼlum	ixtiyoriy
melt	melt	tavsif yoʻq	Nomaʼlum	ixtiyoriy
fusibility	fusibility	tavsif yoʻq	Nomaʼlum	ixtiyoriy
diagnostic	diagnostic	tavsif yoʻq	Nomaʼlum	ixtiyoriy
solubility	solubility	tavsif yoʻq	Nomaʼlum	ixtiyoriy
diaphaneity	diaphaneity	tavsif yoʻq	Nomaʼlum	ixtiyoriy
impurities	impurities	tavsif yoʻq	Nomaʼlum	ixtiyoriy
alteration	alteration	tavsif yoʻq	Nomaʼlum	ixtiyoriy
other	other	tavsif yoʻq	Nomaʼlum	ixtiyoriy
prop1text	prop1text	tavsif yoʻq	Nomaʼlum	ixtiyoriy
references	references	tavsif yoʻq	Nomaʼlum	ixtiyoriy
colour	colour	tavsif yoʻq	Nomaʼlum	ixtiyoriy
lustre	lustre	tavsif yoʻq	Nomaʼlum	ixtiyoriy
polish lustre	polish lustre	tavsif yoʻq	Nomaʼlum	ixtiyoriy
prop1	prop1	tavsif yoʻq	Nomaʼlum	ixtiyoriy
var1	var1	tavsif yoʻq	Nomaʼlum	ixtiyoriy
var1text	var1text	tavsif yoʻq	Nomaʼlum	ixtiyoriy
var2	var2	tavsif yoʻq	Nomaʼlum	ixtiyoriy
var2text	var2text	tavsif yoʻq	Nomaʼlum	ixtiyoriy
var3	var3	tavsif yoʻq	Nomaʼlum	ixtiyoriy
var3text	var3text	tavsif yoʻq	Nomaʼlum	ixtiyoriy
var4	var4	tavsif yoʻq	Nomaʼlum	ixtiyoriy
var4text	var4text	tavsif yoʻq	Nomaʼlum	ixtiyoriy
var5	var5	tavsif yoʻq	Nomaʼlum	ixtiyoriy
var5text	var5text	tavsif yoʻq	Nomaʼlum	ixtiyoriy
var6	var6	tavsif yoʻq	Nomaʼlum	ixtiyoriy
var6text	var6text	tavsif yoʻq	Nomaʼlum	ixtiyoriy
struct image	struct image	tavsif yoʻq	Nomaʼlum	ixtiyoriy
struct2 image	struct2 image	tavsif yoʻq	Nomaʼlum	ixtiyoriy
struct caption	struct caption	tavsif yoʻq	Nomaʼlum	ixtiyoriy
struct imagesize	struct imagesize	tavsif yoʻq	Nomaʼlum	ixtiyoriy
struct alt	struct alt	tavsif yoʻq	Nomaʼlum	ixtiyoriy
struct2 imagesize	struct2 imagesize	tavsif yoʻq	Nomaʼlum	ixtiyoriy
struct2 caption	struct2 caption	tavsif yoʻq	Nomaʼlum	ixtiyoriy
struct2 alt	struct2 alt	tavsif yoʻq	Nomaʼlum	ixtiyoriy
Jmol	Jmol	tavsif yoʻq	Nomaʼlum	ixtiyoriy
SMILES	SMILES	tavsif yoʻq	Nomaʼlum	ixtiyoriy

Tracking category

• Category:Pages using Infobox mineral with unknown parameters (0)